C9H12O2 — CID 144533747
4,5-bis(prop-1-en-2-yl)-1,3-dioxole (PubChem CID 144533747) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4,5-bis(prop-1-en-2-yl)-1,3-dioxole.
| Compound Name | 4,5-bis(prop-1-en-2-yl)-1,3-dioxole |
|---|---|
| PubChem CID | 144533747 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4,5-bis(prop-1-en-2-yl)-1,3-dioxole |
| SMILES | C=C(C)C1=C(C(=C)C)OCO1 |
| InChI | InChI=1S/C9H12O2/c1-6(2)8-9(7(3)4)11-5-10-8/h1,3,5H2,2,4H3 |
| InChIKey | GVNHHGMEQBVAMK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |