C8H12O2S — CID 163629387
1-(5-propan-2-yl-1,3-dioxol-4-yl)ethenethiol (PubChem CID 163629387) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-(5-propan-2-yl-1,3-dioxol-4-yl)ethenethiol.
| Compound Name | 1-(5-propan-2-yl-1,3-dioxol-4-yl)ethenethiol |
|---|---|
| PubChem CID | 163629387 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 1-(5-propan-2-yl-1,3-dioxol-4-yl)ethenethiol |
| SMILES | C=C(S)C1=C(C(C)C)OCO1 |
| InChI | InChI=1S/C8H12O2S/c1-5(2)7-8(6(3)11)10-4-9-7/h5,11H,3-4H2,1-2H3 |
| InChIKey | HUUFADNVGDMDOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|