C15H16O3 — CID 58521537
5-methoxy-4,6-dimethyl-7-(3-methylbut-3-en-1-ynyl)-1,3-benzodioxole (PubChem CID 58521537) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-methoxy-4,6-dimethyl-7-(3-methylbut-3-en-1-ynyl)-1,3-benzodioxole.
| Compound Name | 5-methoxy-4,6-dimethyl-7-(3-methylbut-3-en-1-ynyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 58521537 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-methoxy-4,6-dimethyl-7-(3-methylbut-3-en-1-ynyl)-1,3-benzodioxole |
| SMILES | C=C(C)C#Cc1c(C)c(OC)c(C)c2c1OCO2 |
| InChI | InChI=1S/C15H16O3/c1-9(2)6-7-12-10(3)13(16-5)11(4)14-15(12)18-8-17-14/h1,8H2,2-5H3 |
| InChIKey | UYRDUGFQVSAFAD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|