C8H6Br2O3 — CID 23272203
5,7-dibromo-4-methoxy-1,3-benzodioxole (PubChem CID 23272203) has the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. Its IUPAC name is 5,7-dibromo-4-methoxy-1,3-benzodioxole.
| Compound Name | 5,7-dibromo-4-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 23272203 |
| Molecular Formula | C8H6Br2O3 |
| Molecular Weight | 309.94 g/mol |
| Exact Mass | 307.87 |
| IUPAC Name | 5,7-dibromo-4-methoxy-1,3-benzodioxole |
| SMILES | COc1c(Br)cc(Br)c2c1OCO2 |
| InChI | InChI=1S/C8H6Br2O3/c1-11-6-4(9)2-5(10)7-8(6)13-3-12-7/h2H,3H2,1H3 |
| InChIKey | MLADJFBKPAQNHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.94 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |