C9H14Cl2N2O4 — CID 163333120
4,7-dimethoxy-1,3-benzodioxole-5,6-diamine;dihydrochloride (PubChem CID 163333120) has the molecular formula C9H14Cl2N2O4 and a molecular weight of 285.13 g/mol. Its IUPAC name is 4,7-dimethoxy-1,3-benzodioxole-5,6-diamine;dihydrochloride.
| Compound Name | 4,7-dimethoxy-1,3-benzodioxole-5,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 163333120 |
| Molecular Formula | C9H14Cl2N2O4 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 4,7-dimethoxy-1,3-benzodioxole-5,6-diamine;dihydrochloride |
| SMILES | COc1c(N)c(N)c(OC)c2c1OCO2.Cl.Cl |
| InChI | InChI=1S/C9H12N2O4.2ClH/c1-12-6-4(10)5(11)7(13-2)9-8(6)14-3-15-9;;/h3,10-11H2,1-2H3;2*1H |
| InChIKey | AZUCCPIPBBZPHR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|