C5H8O4 — CID 141112983
4,5-dimethoxy-1,3-dioxole (PubChem CID 141112983) has the molecular formula C5H8O4 and a molecular weight of 132.12 g/mol. Its IUPAC name is 4,5-dimethoxy-1,3-dioxole.
| Compound Name | 4,5-dimethoxy-1,3-dioxole |
|---|---|
| PubChem CID | 141112983 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 4,5-dimethoxy-1,3-dioxole |
| SMILES | COC1=C(OC)OCO1 |
| InChI | InChI=1S/C5H8O4/c1-6-4-5(7-2)9-3-8-4/h3H2,1-2H3 |
| InChIKey | YTPAMVJBEOWLRK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |