About 4,5-dimethoxy-1,3-dioxole
4,5-dimethoxy-1,3-dioxole (PubChem CID 141112983) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is 4,5-dimethoxy-1,3-dioxole.
Molecular Properties
| Compound Name | 4,5-dimethoxy-1,3-dioxole |
| PubChem CID | 141112983 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 4,5-dimethoxy-1,3-dioxole |
| SMILES | COC1=C(OC)OCO1 |
| InChI | InChI=1S/C5H8O4/c1-6-4-5(7-2)9-3-8-4/h3H2,1-2H3 |
| InChIKey | YTPAMVJBEOWLRK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethoxy-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-1,3-dioxole?
The IUPAC name of 4,5-dimethoxy-1,3-dioxole (CID 141112983) is 4,5-dimethoxy-1,3-dioxole.
What is the SMILES notation for 4,5-dimethoxy-1,3-dioxole?
The canonical SMILES for 4,5-dimethoxy-1,3-dioxole is COC1=C(OC)OCO1.
What is the InChIKey of 4,5-dimethoxy-1,3-dioxole?
The InChIKey is YTPAMVJBEOWLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c1-6-4-5(7-2)9-3-8-4/h3H2,1-2H3.
What are the key properties of 4,5-dimethoxy-1,3-dioxole?
4,5-dimethoxy-1,3-dioxole has a molecular weight of 132.12 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-1,3-dioxole is sourced from PubChem (CID 141112983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).