About sodium;2-methylprop-2-enoate;oxetan-2-one
sodium;2-methylprop-2-enoate;oxetan-2-one (PubChem CID 174930235) has the molecular formula C7H9NaO4
and a molecular weight of 180.13 g/mol. Its IUPAC name is sodium;2-methylprop-2-enoate;oxetan-2-one.
Molecular Properties
| Compound Name | sodium;2-methylprop-2-enoate;oxetan-2-one |
| PubChem CID | 174930235 |
| Molecular Formula | C7H9NaO4 |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | sodium;2-methylprop-2-enoate;oxetan-2-one |
| SMILES | C=C(C)C(=O)[O-].O=C1CCO1.[Na+] |
| InChI | InChI=1S/C4H6O2.C3H4O2.Na/c1-3(2)4(5)6;4-3-1-2-5-3;/h1H2,2H3,(H,5,6);1-2H2;/q;;+1/p-1 |
| InChIKey | URSSJMVXQQPTQT-UHFFFAOYSA-M |
| XLogP | -3.75 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methylprop-2-enoate;oxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylprop-2-enoate;oxetan-2-one?
The IUPAC name of sodium;2-methylprop-2-enoate;oxetan-2-one (CID 174930235) is sodium;2-methylprop-2-enoate;oxetan-2-one.
What is the SMILES notation for sodium;2-methylprop-2-enoate;oxetan-2-one?
The canonical SMILES for sodium;2-methylprop-2-enoate;oxetan-2-one is C=C(C)C(=O)[O-].O=C1CCO1.[Na+].
What is the InChIKey of sodium;2-methylprop-2-enoate;oxetan-2-one?
The InChIKey is URSSJMVXQQPTQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.C3H4O2.Na/c1-3(2)4(5)6;4-3-1-2-5-3;/h1H2,2H3,(H,5,6);1-2H2;/q;;+1/p-1.
What are the key properties of sodium;2-methylprop-2-enoate;oxetan-2-one?
sodium;2-methylprop-2-enoate;oxetan-2-one has a molecular weight of 180.13 g/mol, XLogP of -3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylprop-2-enoate;oxetan-2-one is sourced from PubChem (CID 174930235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).