C10H10N2 — CID 143822070
7-methyl-7H-pyrido[2,3-b]azepine (PubChem CID 143822070) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 7-methyl-7H-pyrido[2,3-b]azepine.
| Compound Name | 7-methyl-7H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 143822070 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 7-methyl-7H-pyrido[2,3-b]azepine |
| SMILES | CC1C=Cc2cccnc2N=C1 |
| InChI | InChI=1S/C10H10N2/c1-8-4-5-9-3-2-6-11-10(9)12-7-8/h2-8H,1H3 |
| InChIKey | ZBUDDAYAAPWQFC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |