C23H35N3O — CID 143822803
N'-[(3S)-3-[1-(4-tert-butylphenyl)ethyl-methylamino]-4-oxopentyl]-N-ethenylprop-2-enimidamide (PubChem CID 143822803) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is N'-[(3S)-3-[1-(4-tert-butylphenyl)ethyl-methylamino]-4-oxopentyl]-N-ethenylprop-2-enimidamide.
| Compound Name | N'-[(3S)-3-[1-(4-tert-butylphenyl)ethyl-methylamino]-4-oxopentyl]-N-ethenylprop-2-enimidamide |
|---|---|
| PubChem CID | 143822803 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | N'-[(3S)-3-[1-(4-tert-butylphenyl)ethyl-methylamino]-4-oxopentyl]-N-ethenylprop-2-enimidamide |
| SMILES | C=CN/C(C=C)=N/CC[C@@H](C(C)=O)N(C)C(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H35N3O/c1-9-22(24-10-2)25-16-15-21(18(4)27)26(8)17(3)19-11-13-20(14-12-19)23(5,6)7/h9-14,17,21H,1-2,15-16H2,3-8H3,(H,24,25)/t17?,21-/m0/s1 |
| InChIKey | DQUNJHONYMMLOK-LFABVHOISA-N |
| XLogP | 4.64 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|