C27H34BN5O5 — CID 143824702
tert-butyl N-[[4-[2-[4-[[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]amino]phenyl]ethyl]phenyl]iminomethyl]carbamate (PubChem CID 143824702) has the molecular formula C27H34BN5O5 and a molecular weight of 519.41 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-[4-[[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]amino]phenyl]ethyl]phenyl]iminomethyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-[4-[[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]amino]phenyl]ethyl]phenyl]iminomethyl]carbamate |
|---|---|
| PubChem CID | 143824702 |
| Molecular Formula | C27H34BN5O5 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl N-[[4-[2-[4-[[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]amino]phenyl]ethyl]phenyl]iminomethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C=N/c1ccc(CCc2ccc(N/C(=B/OC#N)NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H34BN5O5/c1-26(2,3)37-24(34)31-18-30-21-13-9-19(10-14-21)7-8-20-11-15-22(16-12-20)32-23(28-36-17-29)33-25(35)38-27(4,5)6/h9-16,18,32H,7-8H2,1-6H3,(H,33,35)(H,30,31,34) |
| InChIKey | PWJKXRBTCOQWEP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|