C19H25ClN2 — CID 143825819
2-methyl-5-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 143825819) has the molecular formula C19H25ClN2 and a molecular weight of 316.88 g/mol. Its IUPAC name is 2-methyl-5-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride.
| Compound Name | 2-methyl-5-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 143825819 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-methyl-5-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | C/C=C\C=C(/C)Cn1c2c(c3ccccc31)CN(C)CC2.Cl |
| InChI | InChI=1S/C19H24N2.ClH/c1-4-5-8-15(2)13-21-18-10-7-6-9-16(18)17-14-20(3)12-11-19(17)21;/h4-10H,11-14H2,1-3H3;1H/b5-4-,15-8+; |
| InChIKey | JNBCLQCBQOTBSR-ZXECDZRNSA-N |
| XLogP | 4.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|