C11H15NS — CID 143830330
N-[(Z)-1-cyclohexa-1,5-dien-1-yl-2-ethylsulfanylethenyl]methanimine (PubChem CID 143830330) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is N-[(Z)-1-cyclohexa-1,5-dien-1-yl-2-ethylsulfanylethenyl]methanimine.
| Compound Name | N-[(Z)-1-cyclohexa-1,5-dien-1-yl-2-ethylsulfanylethenyl]methanimine |
|---|---|
| PubChem CID | 143830330 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[(Z)-1-cyclohexa-1,5-dien-1-yl-2-ethylsulfanylethenyl]methanimine |
| SMILES | C=N/C(=C\SCC)C1=CCCC=C1 |
| InChI | InChI=1S/C11H15NS/c1-3-13-9-11(12-2)10-7-5-4-6-8-10/h5,7-9H,2-4,6H2,1H3/b11-9- |
| InChIKey | PUDGLQZJZCYEKN-LUAWRHEFSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|