C11H10BNO2 — CID 143832241
(5E)-5-benzylidene-1-methyl-1,3-azaborolidine-2,4-dione (PubChem CID 143832241) has the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. Its IUPAC name is (5E)-5-benzylidene-1-methyl-1,3-azaborolidine-2,4-dione.
| Compound Name | (5E)-5-benzylidene-1-methyl-1,3-azaborolidine-2,4-dione |
|---|---|
| PubChem CID | 143832241 |
| Molecular Formula | C11H10BNO2 |
| Molecular Weight | 199.02 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (5E)-5-benzylidene-1-methyl-1,3-azaborolidine-2,4-dione |
| SMILES | CN1C(=O)BC(=O)/C1=C\c1ccccc1 |
| InChI | InChI=1S/C11H10BNO2/c1-13-9(10(14)12-11(13)15)7-8-5-3-2-4-6-8/h2-7,12H,1H3/b9-7+ |
| InChIKey | LKGUSJWUDIKGBC-VQHVLOKHSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.02 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|