C17H28F9N2O+ — CID 143834519
methyl-[3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)propyl]-octylazanium (PubChem CID 143834519) has the molecular formula C17H28F9N2O+ and a molecular weight of 447.41 g/mol. Its IUPAC name is methyl-[3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)propyl]-octylazanium.
| Compound Name | methyl-[3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)propyl]-octylazanium |
|---|---|
| PubChem CID | 143834519 |
| Molecular Formula | C17H28F9N2O+ |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | methyl-[3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)propyl]-octylazanium |
| SMILES | CCCCCCCC[NH+](C)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H27F9N2O/c1-3-4-5-6-7-8-11-28(2)12-9-10-27-13(29)14(18,19)15(20,21)16(22,23)17(24,25)26/h3-12H2,1-2H3,(H,27,29)/p+1 |
| InChIKey | GUOUUUZEIYIXJV-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|