C13H17N3 — CID 143836198
N-(2,3-diiminobutyl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 143836198) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2,3-diiminobutyl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-(2,3-diiminobutyl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 143836198 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-(2,3-diiminobutyl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | [H]/N=C(CNc1ccc2c(c1)CCC2)\C(C)=N\[H] |
| InChI | InChI=1S/C13H17N3/c1-9(14)13(15)8-16-12-6-5-10-3-2-4-11(10)7-12/h5-7,14-16H,2-4,8H2,1H3/b14-9+,15-13- |
| InChIKey | NRCUOIOIVJIGNJ-NECJJZFNSA-N |
| XLogP | 2.65 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|