C24H27F3N3O2- — CID 143837046
(3S)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(3-methylbutyl)-3,5-dihydro-1,4-benzodiazepin-2-olate (PubChem CID 143837046) has the molecular formula C24H27F3N3O2- and a molecular weight of 446.49 g/mol. Its IUPAC name is (3S)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(3-methylbutyl)-3,5-dihydro-1,4-benzodiazepin-2-olate.
| Compound Name | (3S)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(3-methylbutyl)-3,5-dihydro-1,4-benzodiazepin-2-olate |
|---|---|
| PubChem CID | 143837046 |
| Molecular Formula | C24H27F3N3O2- |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3S)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(3-methylbutyl)-3,5-dihydro-1,4-benzodiazepin-2-olate |
| SMILES | CC(C)CC[C@H]1C([O-])=Nc2ccccc2CN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H28F3N3O2/c1-14(2)7-8-22-24(32)29-21-6-4-3-5-15(21)13-30(22)23(31)11-17(28)9-16-10-19(26)20(27)12-18(16)25/h3-6,10,12,14,17,22H,7-9,11,13,28H2,1-2H3,(H,29,32)/p-1/t17-,22+/m1/s1 |
| InChIKey | UPLMXFGRJLWHAE-VGSWGCGISA-M |
| XLogP | 3.60 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|