C20H20F3N3O2 — CID 68638387
4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-methyl-3,5-dihydro-1,4-benzodiazepin-2-one (PubChem CID 68638387) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-methyl-3,5-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-methyl-3,5-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 68638387 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-methyl-3,5-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)CN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)Cc2ccccc21 |
| InChI | InChI=1S/C20H20F3N3O2/c1-25-18-5-3-2-4-12(18)10-26(11-20(25)28)19(27)8-14(24)6-13-7-16(22)17(23)9-15(13)21/h2-5,7,9,14H,6,8,10-11,24H2,1H3 |
| InChIKey | OSEAQOZXKXDBHN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|