C21H23F3N4O2 — CID 143837087
3-amino-1-(1-amino-7-methoxy-2-methylidene-3,5-dihydro-1,4-benzodiazepin-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 143837087) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 3-amino-1-(1-amino-7-methoxy-2-methylidene-3,5-dihydro-1,4-benzodiazepin-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-(1-amino-7-methoxy-2-methylidene-3,5-dihydro-1,4-benzodiazepin-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 143837087 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-amino-1-(1-amino-7-methoxy-2-methylidene-3,5-dihydro-1,4-benzodiazepin-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | C=C1CN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)Cc2cc(OC)ccc2N1N |
| InChI | InChI=1S/C21H23F3N4O2/c1-12-10-27(11-14-6-16(30-2)3-4-20(14)28(12)26)21(29)8-15(25)5-13-7-18(23)19(24)9-17(13)22/h3-4,6-7,9,15H,1,5,8,10-11,25-26H2,2H3 |
| InChIKey | AMAIVIJHDMEOPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|