C20H21F3N3O2+ — CID 143837021
(3R)-3-amino-1-(2-hydroxy-1-methyl-3,5-dihydro-1,4-benzodiazepin-1-ium-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 143837021) has the molecular formula C20H21F3N3O2+ and a molecular weight of 392.40 g/mol. Its IUPAC name is (3R)-3-amino-1-(2-hydroxy-1-methyl-3,5-dihydro-1,4-benzodiazepin-1-ium-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-(2-hydroxy-1-methyl-3,5-dihydro-1,4-benzodiazepin-1-ium-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 143837021 |
| Molecular Formula | C20H21F3N3O2+ |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3R)-3-amino-1-(2-hydroxy-1-methyl-3,5-dihydro-1,4-benzodiazepin-1-ium-4-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | C[N+]1=C(O)CN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)Cc2ccccc21 |
| InChI | InChI=1S/C20H20F3N3O2/c1-25-18-5-3-2-4-12(18)10-26(11-20(25)28)19(27)8-14(24)6-13-7-16(22)17(23)9-15(13)21/h2-5,7,9,14H,6,8,10-11,24H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | OSEAQOZXKXDBHN-CQSZACIVSA-O |
| XLogP | 2.64 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|