C21H21F4N3O2 — CID 74936189
4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-ethyl-8-fluoro-3,5-dihydro-1,4-benzodiazepin-2-one (PubChem CID 74936189) has the molecular formula C21H21F4N3O2 and a molecular weight of 423.41 g/mol. Its IUPAC name is 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-ethyl-8-fluoro-3,5-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-ethyl-8-fluoro-3,5-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 74936189 |
| Molecular Formula | C21H21F4N3O2 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-ethyl-8-fluoro-3,5-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CCN1C(=O)CN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)Cc2ccc(F)cc21 |
| InChI | InChI=1S/C21H21F4N3O2/c1-2-28-19-7-14(22)4-3-12(19)10-27(11-21(28)30)20(29)8-15(26)5-13-6-17(24)18(25)9-16(13)23/h3-4,6-7,9,15H,2,5,8,10-11,26H2,1H3 |
| InChIKey | VQUGZFAOQGZJIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|