C21H21F3N4O4 — CID 54582575
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-nitrophenyl)methyl]piperazin-2-one (PubChem CID 54582575) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-nitrophenyl)methyl]piperazin-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-nitrophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 54582575 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-nitrophenyl)methyl]piperazin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(Cc2ccccc2[N+](=O)[O-])C(=O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H21F3N4O4/c22-16-10-18(24)17(23)8-14(16)7-15(25)9-20(29)27-6-5-26(21(30)12-27)11-13-3-1-2-4-19(13)28(31)32/h1-4,8,10,15H,5-7,9,11-12,25H2/t15-/m1/s1 |
| InChIKey | UUWOGLMRCAJHFI-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|