C27H24F4N6 — CID 143840082
3-[4-(4-fluorophenyl)-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)pyrimidin-5-yl]aniline (PubChem CID 143840082) has the molecular formula C27H24F4N6 and a molecular weight of 508.52 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)pyrimidin-5-yl]aniline.
| Compound Name | 3-[4-(4-fluorophenyl)-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)pyrimidin-5-yl]aniline |
|---|---|
| PubChem CID | 143840082 |
| Molecular Formula | C27H24F4N6 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]-2-(trifluoromethyl)pyrimidin-5-yl]aniline |
| SMILES | Nc1cccc(-c2c(-c3ccc(F)cc3)nc(C(F)(F)F)nc2N2CCN(Cc3ccccn3)CC2)c1 |
| InChI | InChI=1S/C27H24F4N6/c28-20-9-7-18(8-10-20)24-23(19-4-3-5-21(32)16-19)25(35-26(34-24)27(29,30)31)37-14-12-36(13-15-37)17-22-6-1-2-11-33-22/h1-11,16H,12-15,17,32H2 |
| InChIKey | VOQLRUPNGQSXAI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|