C22H19F4N3O — CID 58089372
4-[6-(4-fluorophenyl)-5-(3-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]morpholine (PubChem CID 58089372) has the molecular formula C22H19F4N3O and a molecular weight of 417.41 g/mol. Its IUPAC name is 4-[6-(4-fluorophenyl)-5-(3-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-(4-fluorophenyl)-5-(3-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 58089372 |
| Molecular Formula | C22H19F4N3O |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[6-(4-fluorophenyl)-5-(3-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-yl]morpholine |
| SMILES | Cc1cccc(-c2c(-c3ccc(F)cc3)nc(C(F)(F)F)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C22H19F4N3O/c1-14-3-2-4-16(13-14)18-19(15-5-7-17(23)8-6-15)27-21(22(24,25)26)28-20(18)29-9-11-30-12-10-29/h2-8,13H,9-12H2,1H3 |
| InChIKey | KYXADOHIEBEWBP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |