About 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride
2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride (PubChem CID 143842500) has the molecular formula C8H20Cl2N2O2
and a molecular weight of 247.17 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride |
| PubChem CID | 143842500 |
| Molecular Formula | C8H20Cl2N2O2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride |
| SMILES | CCN(CC)CCN(C)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H18N2O2.2ClH/c1-4-10(5-2)7-6-9(3)8(11)12;;/h4-7H2,1-3H3,(H,11,12);2*1H |
| InChIKey | SDNHRSPXMYOYPE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride?
The IUPAC name of 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride (CID 143842500) is 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride is CCN(CC)CCN(C)C(=O)O.Cl.Cl.
What is the InChIKey of 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride?
The InChIKey is SDNHRSPXMYOYPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2.2ClH/c1-4-10(5-2)7-6-9(3)8(11)12;;/h4-7H2,1-3H3,(H,11,12);2*1H.
What are the key properties of 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride?
2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride has a molecular weight of 247.17 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl-methylcarbamic acid;dihydrochloride is sourced from PubChem (CID 143842500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).