C26H21FN6O2 — CID 143848689
(3R)-1-(4-fluorophenyl)-2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 143848689) has the molecular formula C26H21FN6O2 and a molecular weight of 468.49 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3R)-1-(4-fluorophenyl)-2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 143848689 |
| Molecular Formula | C26H21FN6O2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1Cc2c([nH]c3ccccc23)C(c2ccc(F)cc2)N1Cc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C26H21FN6O2/c27-18-10-8-16(9-11-18)24-23-20(19-6-1-2-7-21(19)28-23)13-22(26(34)35)33(24)14-15-4-3-5-17(12-15)25-29-31-32-30-25/h1-12,22,24,28H,13-14H2,(H,34,35)(H,29,30,31,32)/t22-,24?/m1/s1 |
| InChIKey | ZSALHBGCNKXYEK-LETIRJCYSA-N |
| XLogP | 4.09 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|