C30H40N4O6S — CID 143851221
N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-N-[2-(1-oxoisoquinolin-2-yl)ethyl]methanesulfonamide;methane (PubChem CID 143851221) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-N-[2-(1-oxoisoquinolin-2-yl)ethyl]methanesulfonamide;methane.
| Compound Name | N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-N-[2-(1-oxoisoquinolin-2-yl)ethyl]methanesulfonamide;methane |
|---|---|
| PubChem CID | 143851221 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-N-[2-(1-oxoisoquinolin-2-yl)ethyl]methanesulfonamide;methane |
| SMILES | C.CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCn3ccc4ccccc4c3=O)S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C29H36N4O6S.CH4/c1-6-33-24-13-12-22(20-25(24)30(4)27(35)29(2,3)28(33)36)39-19-9-15-32(40(5,37)38)18-17-31-16-14-21-10-7-8-11-23(21)26(31)34;/h7-8,10-14,16,20H,6,9,15,17-19H2,1-5H3;1H4 |
| InChIKey | UFCIPQPFTHTVOW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|