C8H16O3S — CID 143851287
5-methoxy-2,3-dimethyl-6-sulfanyloxan-4-ol (PubChem CID 143851287) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-6-sulfanyloxan-4-ol.
| Compound Name | 5-methoxy-2,3-dimethyl-6-sulfanyloxan-4-ol |
|---|---|
| PubChem CID | 143851287 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-6-sulfanyloxan-4-ol |
| SMILES | COC1C(S)OC(C)C(C)C1O |
| InChI | InChI=1S/C8H16O3S/c1-4-5(2)11-8(12)7(10-3)6(4)9/h4-9,12H,1-3H3 |
| InChIKey | VCVNXEYIVCXCBB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|