C5H7Cl2F2NO2S — CID 143852239
2-amino-3,4-dichloro-2,3-difluoro-4-methylsulfanylbutanoic acid (PubChem CID 143852239) has the molecular formula C5H7Cl2F2NO2S and a molecular weight of 254.09 g/mol. Its IUPAC name is 2-amino-3,4-dichloro-2,3-difluoro-4-methylsulfanylbutanoic acid.
| Compound Name | 2-amino-3,4-dichloro-2,3-difluoro-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 143852239 |
| Molecular Formula | C5H7Cl2F2NO2S |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 2-amino-3,4-dichloro-2,3-difluoro-4-methylsulfanylbutanoic acid |
| SMILES | CSC(Cl)C(F)(Cl)C(N)(F)C(=O)O |
| InChI | InChI=1S/C5H7Cl2F2NO2S/c1-13-2(6)4(7,8)5(9,10)3(11)12/h2H,10H2,1H3,(H,11,12) |
| InChIKey | VCZZKZARSBLZON-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|