C25H23BrF3NO2 — CID 143857065
2-[4-bromo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetaldehyde (PubChem CID 143857065) has the molecular formula C25H23BrF3NO2 and a molecular weight of 506.36 g/mol. Its IUPAC name is 2-[4-bromo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetaldehyde.
| Compound Name | 2-[4-bromo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 143857065 |
| Molecular Formula | C25H23BrF3NO2 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-[4-bromo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetaldehyde |
| SMILES | O=CCC1CC2(CCN(C(=O)/C=C/c3ccccc3C(F)(F)F)CC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C25H23BrF3NO2/c26-21-7-3-5-19-18(10-15-31)16-24(23(19)21)11-13-30(14-12-24)22(32)9-8-17-4-1-2-6-20(17)25(27,28)29/h1-9,15,18H,10-14,16H2/b9-8+ |
| InChIKey | PXAGHPVAFUVTKG-CMDGGOBGSA-N |
| XLogP | 6.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|