C26H28F3N3O4 — CID 163970330
5-[hydroxy-(2-hydroxyethylamino)methyl]-1-methyl-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 163970330) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 5-[hydroxy-(2-hydroxyethylamino)methyl]-1-methyl-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 5-[hydroxy-(2-hydroxyethylamino)methyl]-1-methyl-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 163970330 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5-[hydroxy-(2-hydroxyethylamino)methyl]-1-methyl-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(C(=O)/C=C/c3ccccc3C(F)(F)F)CC2)c2cc(C(O)NCCO)ccc21 |
| InChI | InChI=1S/C26H28F3N3O4/c1-31-21-8-6-18(23(35)30-12-15-33)16-20(21)25(24(31)36)10-13-32(14-11-25)22(34)9-7-17-4-2-3-5-19(17)26(27,28)29/h2-9,16,23,30,33,35H,10-15H2,1H3/b9-7+ |
| InChIKey | SPLQOWWTESHNCA-VQHVLOKHSA-N |
| XLogP | 2.83 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|