C25H27F3N2O4 — CID 173202933
ethyl 4-[(E)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 173202933) has the molecular formula C25H27F3N2O4 and a molecular weight of 476.50 g/mol. Its IUPAC name is ethyl 4-[(E)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 173202933 |
| Molecular Formula | C25H27F3N2O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl 4-[(E)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)/C=C/c2cccc(C(F)(F)F)c2-c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C25H27F3N2O4/c1-3-33-21-11-6-5-9-19(21)23-18(8-7-10-20(23)25(26,27)28)12-13-22(31)29-14-16-30(17-15-29)24(32)34-4-2/h5-13H,3-4,14-17H2,1-2H3/b13-12+ |
| InChIKey | HUNIEBRTOONZSL-OUKQBFOZSA-N |
| XLogP | 5.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|