C24H25F3N2O3 — CID 173202886
(E)-1-(4-acetylpiperazin-1-yl)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 173202886) has the molecular formula C24H25F3N2O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 173202886 |
| Molecular Formula | C24H25F3N2O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[2-(2-ethoxyphenyl)-3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1-c1c(/C=C/C(=O)N2CCN(C(C)=O)CC2)cccc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N2O3/c1-3-32-21-10-5-4-8-19(21)23-18(7-6-9-20(23)24(25,26)27)11-12-22(31)29-15-13-28(14-16-29)17(2)30/h4-12H,3,13-16H2,1-2H3/b12-11+ |
| InChIKey | YXNOQRZNKWNUBG-VAWYXSNFSA-N |
| XLogP | 4.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|