C24H23F3N2O5 — CID 173202776
methyl 4-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 173202776) has the molecular formula C24H23F3N2O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is methyl 4-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 173202776 |
| Molecular Formula | C24H23F3N2O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 4-[(E)-3-[2-(3,4-dihydro-1,2-benzodioxin-6-yl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)/C=C/c2cccc(C(F)(F)F)c2-c2ccc3c(c2)CCOO3)CC1 |
| InChI | InChI=1S/C24H23F3N2O5/c1-32-23(31)29-12-10-28(11-13-29)21(30)8-6-16-3-2-4-19(24(25,26)27)22(16)18-5-7-20-17(15-18)9-14-33-34-20/h2-8,15H,9-14H2,1H3/b8-6+ |
| InChIKey | YQVSNZYNYKVGIL-SOFGYWHQSA-N |
| XLogP | 4.16 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|