C23H24F3N3O2 — CID 89148806
5-amino-1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 89148806) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 5-amino-1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 5-amino-1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 89148806 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 5-amino-1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(C(=O)CCc3ccccc3C(F)(F)F)CC2)c2cc(N)ccc21 |
| InChI | InChI=1S/C23H24F3N3O2/c1-28-19-8-7-16(27)14-18(19)22(21(28)31)10-12-29(13-11-22)20(30)9-6-15-4-2-3-5-17(15)23(24,25)26/h2-5,7-8,14H,6,9-13,27H2,1H3 |
| InChIKey | OIKHURJELRKUJC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|