C27H29F3N2O3 — CID 89415874
1-ethyl-5-(1-methoxyethenyl)-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 89415874) has the molecular formula C27H29F3N2O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 1-ethyl-5-(1-methoxyethenyl)-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-ethyl-5-(1-methoxyethenyl)-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 89415874 |
| Molecular Formula | C27H29F3N2O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 1-ethyl-5-(1-methoxyethenyl)-1'-[3-[2-(trifluoromethyl)phenyl]propanoyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | C=C(OC)c1ccc2c(c1)C1(CCN(C(=O)CCc3ccccc3C(F)(F)F)CC1)C(=O)N2CC |
| InChI | InChI=1S/C27H29F3N2O3/c1-4-32-23-11-9-20(18(2)35-3)17-22(23)26(25(32)34)13-15-31(16-14-26)24(33)12-10-19-7-5-6-8-21(19)27(28,29)30/h5-9,11,17H,2,4,10,12-16H2,1,3H3 |
| InChIKey | FGBIJQVGNAFSFT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|