C23H21BrF3NO2 — CID 87575853
(Z)-3-(4-bromo-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enal (PubChem CID 87575853) has the molecular formula C23H21BrF3NO2 and a molecular weight of 480.32 g/mol. Its IUPAC name is (Z)-3-(4-bromo-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enal.
| Compound Name | (Z)-3-(4-bromo-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 87575853 |
| Molecular Formula | C23H21BrF3NO2 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | (Z)-3-(4-bromo-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enal |
| SMILES | O=C/C=C(/c1ccccc1C(F)(F)F)N1CCC2(CC1)CC(O)c1cccc(Br)c12 |
| InChI | InChI=1S/C23H21BrF3NO2/c24-18-7-3-5-16-20(30)14-22(21(16)18)9-11-28(12-10-22)19(8-13-29)15-4-1-2-6-17(15)23(25,26)27/h1-8,13,20,30H,9-12,14H2/b19-8- |
| InChIKey | QCJPSQGFAWLDGJ-UWVJOHFNSA-N |
| XLogP | 5.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|