C32H42N6O2 — CID 143861801
1-[[5-[[4-[4-(6-aminohexan-3-yl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]pyrrolidine-2-carbaldehyde (PubChem CID 143861801) has the molecular formula C32H42N6O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 1-[[5-[[4-[4-(6-aminohexan-3-yl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]pyrrolidine-2-carbaldehyde.
| Compound Name | 1-[[5-[[4-[4-(6-aminohexan-3-yl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 143861801 |
| Molecular Formula | C32H42N6O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 1-[[5-[[4-[4-(6-aminohexan-3-yl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylphenyl]methyl]pyrrolidine-2-carbaldehyde |
| SMILES | CCC(CCCN)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)c(CN4CCCC4C=O)c3)n2)cc1 |
| InChI | InChI=1S/C32H42N6O2/c1-2-24(5-3-14-33)25-7-9-26(10-8-25)30-13-15-34-32(36-30)35-28-11-12-31(37-17-19-40-20-18-37)27(21-28)22-38-16-4-6-29(38)23-39/h7-13,15,21,23-24,29H,2-6,14,16-20,22,33H2,1H3,(H,34,35,36) |
| InChIKey | AXEVXVNLFPPMAF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|