C26H25F3N4O3S — CID 143865342
[3-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] 2-amino-N-ethenyl-4,5-dimethoxybenzenecarboximidothioate (PubChem CID 143865342) has the molecular formula C26H25F3N4O3S and a molecular weight of 530.57 g/mol. Its IUPAC name is [3-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] 2-amino-N-ethenyl-4,5-dimethoxybenzenecarboximidothioate.
| Compound Name | [3-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] 2-amino-N-ethenyl-4,5-dimethoxybenzenecarboximidothioate |
|---|---|
| PubChem CID | 143865342 |
| Molecular Formula | C26H25F3N4O3S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [3-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] 2-amino-N-ethenyl-4,5-dimethoxybenzenecarboximidothioate |
| SMILES | C=C/N=C(\Sc1cccc(NC(=O)Nc2ccc(C)c(C(F)(F)F)c2)c1)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C26H25F3N4O3S/c1-5-31-24(19-13-22(35-3)23(36-4)14-21(19)30)37-18-8-6-7-16(11-18)32-25(34)33-17-10-9-15(2)20(12-17)26(27,28)29/h5-14H,1,30H2,2-4H3,(H2,32,33,34)/b31-24- |
| InChIKey | UBERUMNXTIEXIB-QLTSDVKISA-N |
| XLogP | 6.94 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|