C11H8ClFN2O — CID 143866898
1-[1-(3-chloro-5-fluoro-2-pyridinyl)pyrrol-2-yl]ethanone (PubChem CID 143866898) has the molecular formula C11H8ClFN2O and a molecular weight of 238.65 g/mol. Its IUPAC name is 1-[1-(3-chloro-5-fluoro-2-pyridinyl)pyrrol-2-yl]ethanone.
| Compound Name | 1-[1-(3-chloro-5-fluoro-2-pyridinyl)pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 143866898 |
| Molecular Formula | C11H8ClFN2O |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-[1-(3-chloro-5-fluoro-2-pyridinyl)pyrrol-2-yl]ethanone |
| SMILES | CC(=O)c1cccn1-c1ncc(F)cc1Cl |
| InChI | InChI=1S/C11H8ClFN2O/c1-7(16)10-3-2-4-15(10)11-9(12)5-8(13)6-14-11/h2-6H,1H3 |
| InChIKey | ZNGLVYNXZXHFCX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |