C16H21N3OS — CID 143870229
2-[4-(diethylamino)phenyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-ol (PubChem CID 143870229) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-ol.
| Compound Name | 2-[4-(diethylamino)phenyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 143870229 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-ol |
| SMILES | CCN(CC)c1ccc(-c2nc3c(s2)C(O)CNC3)cc1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-19(4-2)12-7-5-11(6-8-12)16-18-13-9-17-10-14(20)15(13)21-16/h5-8,14,17,20H,3-4,9-10H2,1-2H3 |
| InChIKey | FALQCZRMYBTGDJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|