C24H31O6P — CID 143873587
(1R,2S,4S,5S,7S,8R,9S,11S,14R)-12-ethyl-1-methyl-14-phosphanyl-7-propan-2-ylspiro[3,6,10,17-tetraoxaheptacyclo[12.7.0.02,4.02,9.05,7.09,11.015,19]henicos-15(19)-ene-8,2'-oxirane]-18-one (PubChem CID 143873587) has the molecular formula C24H31O6P and a molecular weight of 446.48 g/mol. Its IUPAC name is (1R,2S,4S,5S,7S,8R,9S,11S,14R)-12-ethyl-1-methyl-14-phosphanyl-7-propan-2-ylspiro[3,6,10,17-tetraoxaheptacyclo[12.7.0.02,4.02,9.05,7.09,11.015,19]henicos-15(19)-ene-8,2'-oxirane]-18-one.
| Compound Name | (1R,2S,4S,5S,7S,8R,9S,11S,14R)-12-ethyl-1-methyl-14-phosphanyl-7-propan-2-ylspiro[3,6,10,17-tetraoxaheptacyclo[12.7.0.02,4.02,9.05,7.09,11.015,19]henicos-15(19)-ene-8,2'-oxirane]-18-one |
|---|---|
| PubChem CID | 143873587 |
| Molecular Formula | C24H31O6P |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (1R,2S,4S,5S,7S,8R,9S,11S,14R)-12-ethyl-1-methyl-14-phosphanyl-7-propan-2-ylspiro[3,6,10,17-tetraoxaheptacyclo[12.7.0.02,4.02,9.05,7.09,11.015,19]henicos-15(19)-ene-8,2'-oxirane]-18-one |
| SMILES | CCC1C[C@@]2(P)C3=C(CC[C@]2(C)[C@]24O[C@H]2[C@@H]2O[C@]2(C(C)C)[C@]2(CO2)[C@@]42O[C@@H]12)C(=O)OC3 |
| InChI | InChI=1S/C24H31O6P/c1-5-12-8-20(31)14-9-26-18(25)13(14)6-7-19(20,4)23-17(30-23)16-22(28-16,11(2)3)21(10-27-21)24(23)15(12)29-24/h11-12,15-17H,5-10,31H2,1-4H3/t12?,15-,16-,17-,19-,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | AMFQXWYCNVJFFE-DNQQMESDSA-N |
| XLogP | 2.54 |
| TPSA | 76.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|