C23H32O6 — CID 144602715
(1S,3S,5S,13R,16R,17S,19R)-5-hydroxy-13,20,20-trimethyl-19-propan-2-yl-2,8,15,18-tetraoxahexacyclo[14.4.1.01,3.05,13.06,10.017,19]henicos-6(10)-en-9-one (PubChem CID 144602715) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (1S,3S,5S,13R,16R,17S,19R)-5-hydroxy-13,20,20-trimethyl-19-propan-2-yl-2,8,15,18-tetraoxahexacyclo[14.4.1.01,3.05,13.06,10.017,19]henicos-6(10)-en-9-one.
| Compound Name | (1S,3S,5S,13R,16R,17S,19R)-5-hydroxy-13,20,20-trimethyl-19-propan-2-yl-2,8,15,18-tetraoxahexacyclo[14.4.1.01,3.05,13.06,10.017,19]henicos-6(10)-en-9-one |
|---|---|
| PubChem CID | 144602715 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1S,3S,5S,13R,16R,17S,19R)-5-hydroxy-13,20,20-trimethyl-19-propan-2-yl-2,8,15,18-tetraoxahexacyclo[14.4.1.01,3.05,13.06,10.017,19]henicos-6(10)-en-9-one |
| SMILES | CC(C)[C@]12O[C@H]1[C@H]1C[C@]3(O[C@H]3C[C@@]3(O)C4=C(CC[C@]3(C)CO1)C(=O)OC4)C2(C)C |
| InChI | InChI=1S/C23H32O6/c1-12(2)23-17(29-23)15-8-22(19(23,3)4)16(28-22)9-21(25)14-10-26-18(24)13(14)6-7-20(21,5)11-27-15/h12,15-17,25H,6-11H2,1-5H3/t15-,16+,17+,20-,21-,22-,23+/m1/s1 |
| InChIKey | GYQQLEPMMRFMPV-VLMIAZFOSA-N |
| XLogP | 2.52 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|