C17H33F3N2O — CID 143876430
1-methyl-4-(2-methylpropoxy)piperidine;1-methyl-4-(trifluoromethyl)piperidine (PubChem CID 143876430) has the molecular formula C17H33F3N2O and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-methyl-4-(2-methylpropoxy)piperidine;1-methyl-4-(trifluoromethyl)piperidine.
| Compound Name | 1-methyl-4-(2-methylpropoxy)piperidine;1-methyl-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 143876430 |
| Molecular Formula | C17H33F3N2O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-methyl-4-(2-methylpropoxy)piperidine;1-methyl-4-(trifluoromethyl)piperidine |
| SMILES | CC(C)COC1CCN(C)CC1.CN1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H21NO.C7H12F3N/c1-9(2)8-12-10-4-6-11(3)7-5-10;1-11-4-2-6(3-5-11)7(8,9)10/h9-10H,4-8H2,1-3H3;6H,2-5H2,1H3 |
| InChIKey | JKVLWMCDJNJEEI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |