C28H28BrN3O4 — CID 143878413
[1'-[2-(4-bromoanilino)-2-oxoethyl]-8-ethoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-oxidoazanium (PubChem CID 143878413) has the molecular formula C28H28BrN3O4 and a molecular weight of 550.45 g/mol. Its IUPAC name is [1'-[2-(4-bromoanilino)-2-oxoethyl]-8-ethoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-oxidoazanium.
| Compound Name | [1'-[2-(4-bromoanilino)-2-oxoethyl]-8-ethoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-oxidoazanium |
|---|---|
| PubChem CID | 143878413 |
| Molecular Formula | C28H28BrN3O4 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | [1'-[2-(4-bromoanilino)-2-oxoethyl]-8-ethoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-yl]-oxidoazanium |
| SMILES | CCOc1cc([NH2+][O-])cc2c1OC1(C=C2)N(CC(=O)Nc2ccc(Br)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C28H28BrN3O4/c1-4-35-24-16-21(31-34)15-18-13-14-28(36-26(18)24)27(2,3)22-7-5-6-8-23(22)32(28)17-25(33)30-20-11-9-19(29)10-12-20/h5-16H,4,17,31H2,1-3H3,(H,30,33) |
| InChIKey | OBHVWIWNYOQXKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|