C24H34N6O4 — CID 143878501
(2S)-N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-[2-methanimidoyl-3-(methylamino)phenoxy]-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide (PubChem CID 143878501) has the molecular formula C24H34N6O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2S)-N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-[2-methanimidoyl-3-(methylamino)phenoxy]-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-[2-methanimidoyl-3-(methylamino)phenoxy]-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 143878501 |
| Molecular Formula | C24H34N6O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (2S)-N-[(Z)-1-amino-3-(3-hydroxypropylamino)prop-2-enylidene]-2-[3-[2-methanimidoyl-3-(methylamino)phenoxy]-5-oxo-2H-pyrrol-1-yl]-4-methylpentanamide |
| SMILES | [H]/N=C/c1c(NC)cccc1OC1=CC(=O)N([C@@H](CC(C)C)C(=O)/N=C(N)/C=C\NCCCO)C1 |
| InChI | InChI=1S/C24H34N6O4/c1-16(2)12-20(24(33)29-22(26)8-10-28-9-5-11-31)30-15-17(13-23(30)32)34-21-7-4-6-19(27-3)18(21)14-25/h4,6-8,10,13-14,16,20,25,27-28,31H,5,9,11-12,15H2,1-3H3,(H2,26,29,33)/b10-8-,25-14+/t20-/m0/s1 |
| InChIKey | VKHALLDWSGUHQF-MHLJICGQSA-N |
| XLogP | 1.62 |
| TPSA | 153.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|