C18H23NO5 — CID 66893466
methyl (2S)-2-[3-(3-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanoate (PubChem CID 66893466) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (2S)-2-[3-(3-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[3-(3-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 66893466 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (2S)-2-[3-(3-methoxyphenoxy)-5-oxo-2H-pyrrol-1-yl]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N1CC(Oc2cccc(OC)c2)=CC1=O |
| InChI | InChI=1S/C18H23NO5/c1-12(2)8-16(18(21)23-4)19-11-15(10-17(19)20)24-14-7-5-6-13(9-14)22-3/h5-7,9-10,12,16H,8,11H2,1-4H3/t16-/m0/s1 |
| InChIKey | CLQKHIVGCMLZJE-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |