C25H25F3N4O3 — CID 143880558
formamide;(6-phenyl-3-pyridinyl)-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]methanone (PubChem CID 143880558) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is formamide;(6-phenyl-3-pyridinyl)-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]methanone.
| Compound Name | formamide;(6-phenyl-3-pyridinyl)-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 143880558 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | formamide;(6-phenyl-3-pyridinyl)-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]methanone |
| SMILES | NC=O.O=C(c1ccc(-c2ccccc2)nc1)N1CCC(Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H22F3N3O2.CH3NO/c25-24(26,27)32-21-9-7-19(8-10-21)29-20-12-14-30(15-13-20)23(31)18-6-11-22(28-16-18)17-4-2-1-3-5-17;2-1-3/h1-11,16,20,29H,12-15H2;1H,(H2,2,3) |
| InChIKey | XHMQZISFFSJAGP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|