About molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate
molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate (PubChem CID 143885734) has the molecular formula C16H29N5O3
and a molecular weight of 339.44 g/mol. Its IUPAC name is molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate.
Molecular Properties
| Compound Name | molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate |
| PubChem CID | 143885734 |
| Molecular Formula | C16H29N5O3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1nnnc1C1(N2CCOCC2)CCCCCC1.[H][H] |
| InChI | InChI=1S/C16H27N5O3.H2/c1-14(22)24-13-10-21-15(17-18-19-21)16(6-4-2-3-5-7-16)20-8-11-23-12-9-20;/h2-13H2,1H3;1H |
| InChIKey | UHJHQPCFGVGOSQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate?
The IUPAC name of molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate (CID 143885734) is molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate.
What is the SMILES notation for molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate?
The canonical SMILES for molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate is CC(=O)OCCn1nnnc1C1(N2CCOCC2)CCCCCC1.[H][H].
What is the InChIKey of molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate?
The InChIKey is UHJHQPCFGVGOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O3.H2/c1-14(22)24-13-10-21-15(17-18-19-21)16(6-4-2-3-5-7-16)20-8-11-23-12-9-20;/h2-13H2,1H3;1H.
What are the key properties of molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate?
molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate has a molecular weight of 339.44 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;2-[5-(1-morpholin-4-ylcycloheptyl)tetrazol-1-yl]ethyl acetate is sourced from PubChem (CID 143885734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).