C23H36F2O3 — CID 143889380
2-but-3-enyl-5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]oxane (PubChem CID 143889380) has the molecular formula C23H36F2O3 and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-but-3-enyl-5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]oxane.
| Compound Name | 2-but-3-enyl-5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]oxane |
|---|---|
| PubChem CID | 143889380 |
| Molecular Formula | C23H36F2O3 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 2-but-3-enyl-5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]oxane |
| SMILES | C=CCCC1CCC(COC(C)CCC(C)C2=C(F)C(F)=C(OC)CC2)CO1 |
| InChI | InChI=1S/C23H36F2O3/c1-5-6-7-19-11-10-18(15-28-19)14-27-17(3)9-8-16(2)20-12-13-21(26-4)23(25)22(20)24/h5,16-19H,1,6-15H2,2-4H3 |
| InChIKey | LXKNTGMDCQWGDA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|