C20H37N3O — CID 143890167
1-cyclohexyl-3-methyl-1-[1-(4-methylcyclohexyl)piperidin-4-yl]urea (PubChem CID 143890167) has the molecular formula C20H37N3O and a molecular weight of 335.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-methyl-1-[1-(4-methylcyclohexyl)piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-methyl-1-[1-(4-methylcyclohexyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 143890167 |
| Molecular Formula | C20H37N3O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.29 |
| IUPAC Name | 1-cyclohexyl-3-methyl-1-[1-(4-methylcyclohexyl)piperidin-4-yl]urea |
| SMILES | CNC(=O)N(C1CCCCC1)C1CCN(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O/c1-16-8-10-17(11-9-16)22-14-12-19(13-15-22)23(20(24)21-2)18-6-4-3-5-7-18/h16-19H,3-15H2,1-2H3,(H,21,24) |
| InChIKey | ZEONFZJZIVCORP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |